C18H34O2 — CID 57075289
2-[(1S,2S)-5,5-dimethyl-2-octoxycyclohexyl]acetaldehyde (PubChem CID 57075289) has the molecular formula C18H34O2 and a molecular weight of 282.47 g/mol. Its IUPAC name is 2-[(1S,2S)-5,5-dimethyl-2-octoxycyclohexyl]acetaldehyde.
| Compound Name | 2-[(1S,2S)-5,5-dimethyl-2-octoxycyclohexyl]acetaldehyde |
|---|---|
| PubChem CID | 57075289 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | 2-[(1S,2S)-5,5-dimethyl-2-octoxycyclohexyl]acetaldehyde |
| SMILES | CCCCCCCCO[C@H]1CCC(C)(C)C[C@H]1CC=O |
| InChI | InChI=1S/C18H34O2/c1-4-5-6-7-8-9-14-20-17-10-12-18(2,3)15-16(17)11-13-19/h13,16-17H,4-12,14-15H2,1-3H3/t16-,17+/m1/s1 |
| InChIKey | LWLSCPPGGDJBSA-SJORKVTESA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|