C8H14O6 — CID 67674540
(2R,3R,4R,5S,6S)-6-(1-hydroxyprop-1-enyl)oxane-2,3,4,5-tetrol (PubChem CID 67674540) has the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-6-(1-hydroxyprop-1-enyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4R,5S,6S)-6-(1-hydroxyprop-1-enyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 67674540 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (2R,3R,4R,5S,6S)-6-(1-hydroxyprop-1-enyl)oxane-2,3,4,5-tetrol |
| SMILES | CC=C(O)[C@H]1O[C@@H](O)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H14O6/c1-2-3(9)7-5(11)4(10)6(12)8(13)14-7/h2,4-13H,1H3/t4-,5+,6-,7-,8-/m1/s1 |
| InChIKey | IWGSAFVUIPJTDE-OZRXBMAMSA-N |
| XLogP | -1.75 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|