About 2H-chromene;hexane-1,6-diamine
2H-chromene;hexane-1,6-diamine (PubChem CID 67675433) has the molecular formula C15H24N2O
and a molecular weight of 248.37 g/mol. Its IUPAC name is 2H-chromene;hexane-1,6-diamine.
Molecular Properties
| Compound Name | 2H-chromene;hexane-1,6-diamine |
| PubChem CID | 67675433 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 2H-chromene;hexane-1,6-diamine |
| SMILES | C1=Cc2ccccc2OC1.NCCCCCCN |
| InChI | InChI=1S/C9H8O.C6H16N2/c1-2-6-9-8(4-1)5-3-7-10-9;7-5-3-1-2-4-6-8/h1-6H,7H2;1-8H2 |
| InChIKey | FRHRHQJRZYHHCP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2H-chromene;hexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-chromene;hexane-1,6-diamine?
The IUPAC name of 2H-chromene;hexane-1,6-diamine (CID 67675433) is 2H-chromene;hexane-1,6-diamine.
What is the SMILES notation for 2H-chromene;hexane-1,6-diamine?
The canonical SMILES for 2H-chromene;hexane-1,6-diamine is C1=Cc2ccccc2OC1.NCCCCCCN.
What is the InChIKey of 2H-chromene;hexane-1,6-diamine?
The InChIKey is FRHRHQJRZYHHCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O.C6H16N2/c1-2-6-9-8(4-1)5-3-7-10-9;7-5-3-1-2-4-6-8/h1-6H,7H2;1-8H2.
What are the key properties of 2H-chromene;hexane-1,6-diamine?
2H-chromene;hexane-1,6-diamine has a molecular weight of 248.37 g/mol, XLogP of 2.56, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-chromene;hexane-1,6-diamine is sourced from PubChem (CID 67675433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).