C13H21N2O2P — CID 67675456
4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide (PubChem CID 67675456) has the molecular formula C13H21N2O2P and a molecular weight of 268.30 g/mol. Its IUPAC name is 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide.
| Compound Name | 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide |
|---|---|
| PubChem CID | 67675456 |
| Molecular Formula | C13H21N2O2P |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide |
| SMILES | CC(C)CCC(=O)NN[P@](C)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H21N2O2P/c1-11(2)9-10-13(16)14-15-18(3,17)12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3,(H,14,16)(H,15,17)/t18-/m1/s1 |
| InChIKey | NOSDZLMOLZWCCR-GOSISDBHSA-N |
| XLogP | 2.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|