About 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide
4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide (PubChem CID 67675456) has the molecular formula C13H21N2O2P
and a molecular weight of 268.30 g/mol. Its IUPAC name is 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide.
Molecular Properties
| Compound Name | 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide |
| PubChem CID | 67675456 |
| Molecular Formula | C13H21N2O2P |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide |
| SMILES | CC(C)CCC(=O)NN[P@](C)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H21N2O2P/c1-11(2)9-10-13(16)14-15-18(3,17)12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3,(H,14,16)(H,15,17)/t18-/m1/s1 |
| InChIKey | NOSDZLMOLZWCCR-GOSISDBHSA-N |
| XLogP | 2.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide?
The IUPAC name of 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide (CID 67675456) is 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide.
What is the SMILES notation for 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide?
The canonical SMILES for 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide is CC(C)CCC(=O)NN[P@](C)(=O)c1ccccc1.
What is the InChIKey of 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide?
The InChIKey is NOSDZLMOLZWCCR-GOSISDBHSA-N. The full InChI is InChI=1S/C13H21N2O2P/c1-11(2)9-10-13(16)14-15-18(3,17)12-7-5-4-6-8-12/h4-8,11H,9-10H2,1-3H3,(H,14,16)(H,15,17)/t18-/m1/s1.
What are the key properties of 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide?
4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide has a molecular weight of 268.30 g/mol, XLogP of 2.28, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N'-[methyl(phenyl)phosphoryl]pentanehydrazide is sourced from PubChem (CID 67675456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).