C16H30O3 — CID 67678236
2-cyclopentyl-2-(1-methoxypropyl)-5-methylhexanoic acid (PubChem CID 67678236) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 2-cyclopentyl-2-(1-methoxypropyl)-5-methylhexanoic acid.
| Compound Name | 2-cyclopentyl-2-(1-methoxypropyl)-5-methylhexanoic acid |
|---|---|
| PubChem CID | 67678236 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 2-cyclopentyl-2-(1-methoxypropyl)-5-methylhexanoic acid |
| SMILES | CCC(OC)C(CCC(C)C)(C(=O)O)C1CCCC1 |
| InChI | InChI=1S/C16H30O3/c1-5-14(19-4)16(15(17)18,11-10-12(2)3)13-8-6-7-9-13/h12-14H,5-11H2,1-4H3,(H,17,18) |
| InChIKey | SSFZAJWGTVVKLP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |