C30H35F2N5OSi — CID 67678964
[2,6-difluoro-4-[(9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]spiro[3,6,7,8-tetrahydropyrido[1,2-b][1,2,4]triazine-2,1'-cyclopropane]-4-yl]phenyl]-trimethylsilane (PubChem CID 67678964) has the molecular formula C30H35F2N5OSi and a molecular weight of 547.73 g/mol. Its IUPAC name is [2,6-difluoro-4-[(9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]spiro[3,6,7,8-tetrahydropyrido[1,2-b][1,2,4]triazine-2,1'-cyclopropane]-4-yl]phenyl]-trimethylsilane.
| Compound Name | [2,6-difluoro-4-[(9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]spiro[3,6,7,8-tetrahydropyrido[1,2-b][1,2,4]triazine-2,1'-cyclopropane]-4-yl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 67678964 |
| Molecular Formula | C30H35F2N5OSi |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | [2,6-difluoro-4-[(9E)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]spiro[3,6,7,8-tetrahydropyrido[1,2-b][1,2,4]triazine-2,1'-cyclopropane]-4-yl]phenyl]-trimethylsilane |
| SMILES | COc1cc(/C=C2\CCCN3C2=NC2(CC2)CN3c2cc(F)c([Si](C)(C)C)c(F)c2)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C30H35F2N5OSi/c1-20-17-35(19-33-20)26-9-8-21(14-27(26)38-2)13-22-7-6-12-36-29(22)34-30(10-11-30)18-37(36)23-15-24(31)28(25(32)16-23)39(3,4)5/h8-9,13-17,19H,6-7,10-12,18H2,1-5H3/b22-13+ |
| InChIKey | BKOKMOGPFJATNC-LPYMAVHISA-N |
| XLogP | 5.86 |
| TPSA | 45.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|