C17H15Cl2N3O3S — CID 67684530
1-(3,4-dichlorophenyl)-3-(1-ethylindol-6-yl)sulfonylurea (PubChem CID 67684530) has the molecular formula C17H15Cl2N3O3S and a molecular weight of 412.30 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(1-ethylindol-6-yl)sulfonylurea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(1-ethylindol-6-yl)sulfonylurea |
|---|---|
| PubChem CID | 67684530 |
| Molecular Formula | C17H15Cl2N3O3S |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(1-ethylindol-6-yl)sulfonylurea |
| SMILES | CCn1ccc2ccc(S(=O)(=O)NC(=O)Nc3ccc(Cl)c(Cl)c3)cc21 |
| InChI | InChI=1S/C17H15Cl2N3O3S/c1-2-22-8-7-11-3-5-13(10-16(11)22)26(24,25)21-17(23)20-12-4-6-14(18)15(19)9-12/h3-10H,2H2,1H3,(H2,20,21,23) |
| InChIKey | QAFMHIDYTYFRGB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |