C14H23N3O4 — CID 67691802
1-(2-carboxyethyl)cyclopentane-1-carboxylic acid;2-(1H-imidazol-5-yl)ethanamine (PubChem CID 67691802) has the molecular formula C14H23N3O4 and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-(2-carboxyethyl)cyclopentane-1-carboxylic acid;2-(1H-imidazol-5-yl)ethanamine.
| Compound Name | 1-(2-carboxyethyl)cyclopentane-1-carboxylic acid;2-(1H-imidazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 67691802 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-(2-carboxyethyl)cyclopentane-1-carboxylic acid;2-(1H-imidazol-5-yl)ethanamine |
| SMILES | NCCc1cnc[nH]1.O=C(O)CCC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C9H14O4.C5H9N3/c10-7(11)3-6-9(8(12)13)4-1-2-5-9;6-2-1-5-3-7-4-8-5/h1-6H2,(H,10,11)(H,12,13);3-4H,1-2,6H2,(H,7,8) |
| InChIKey | IBGSEQRKRIZIDN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 129.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |