C16H20N6O5 — CID 67695699
(Z)-but-2-enedioic acid;6-(4-methylpiperazin-1-yl)-2H-pyrazolo[3,4-b]pyridine-3-carboxamide (PubChem CID 67695699) has the molecular formula C16H20N6O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;6-(4-methylpiperazin-1-yl)-2H-pyrazolo[3,4-b]pyridine-3-carboxamide.
| Compound Name | (Z)-but-2-enedioic acid;6-(4-methylpiperazin-1-yl)-2H-pyrazolo[3,4-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 67695699 |
| Molecular Formula | C16H20N6O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;6-(4-methylpiperazin-1-yl)-2H-pyrazolo[3,4-b]pyridine-3-carboxamide |
| SMILES | CN1CCN(c2ccc3c(C(N)=O)[nH]nc3n2)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C12H16N6O.C4H4O4/c1-17-4-6-18(7-5-17)9-3-2-8-10(11(13)19)15-16-12(8)14-9;5-3(6)1-2-4(7)8/h2-3H,4-7H2,1H3,(H2,13,19)(H,14,15,16);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | AXYJHCQBAMQIAB-BTJKTKAUSA-N |
| XLogP | -0.48 |
| TPSA | 165.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|