C20H25N3O4S — CID 68620754
(E)-but-2-enedioic acid;1-(6-ethyl-4-thiophen-3-yl-2-pyridinyl)-4-methylpiperazine (PubChem CID 68620754) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-(6-ethyl-4-thiophen-3-yl-2-pyridinyl)-4-methylpiperazine.
| Compound Name | (E)-but-2-enedioic acid;1-(6-ethyl-4-thiophen-3-yl-2-pyridinyl)-4-methylpiperazine |
|---|---|
| PubChem CID | 68620754 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (E)-but-2-enedioic acid;1-(6-ethyl-4-thiophen-3-yl-2-pyridinyl)-4-methylpiperazine |
| SMILES | CCc1cc(-c2ccsc2)cc(N2CCN(C)CC2)n1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H21N3S.C4H4O4/c1-3-15-10-14(13-4-9-20-12-13)11-16(17-15)19-7-5-18(2)6-8-19;5-3(6)1-2-4(7)8/h4,9-12H,3,5-8H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | WWKAHOYJOWJCMX-WLHGVMLRSA-N |
| XLogP | 2.84 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|