C18H25N3S — CID 46203977
1-(6-tert-butyl-4-thiophen-3-yl-2-pyridinyl)-4-methylpiperazine (PubChem CID 46203977) has the molecular formula C18H25N3S and a molecular weight of 315.49 g/mol. Its IUPAC name is 1-(6-tert-butyl-4-thiophen-3-yl-2-pyridinyl)-4-methylpiperazine.
| Compound Name | 1-(6-tert-butyl-4-thiophen-3-yl-2-pyridinyl)-4-methylpiperazine |
|---|---|
| PubChem CID | 46203977 |
| Molecular Formula | C18H25N3S |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1-(6-tert-butyl-4-thiophen-3-yl-2-pyridinyl)-4-methylpiperazine |
| SMILES | CN1CCN(c2cc(-c3ccsc3)cc(C(C)(C)C)n2)CC1 |
| InChI | InChI=1S/C18H25N3S/c1-18(2,3)16-11-15(14-5-10-22-13-14)12-17(19-16)21-8-6-20(4)7-9-21/h5,10-13H,6-9H2,1-4H3 |
| InChIKey | RELOKIWPUZSMRE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |