C24H31N3O4S — CID 68620387
but-2-enedioic acid;1-(6-cyclohexyl-4-thiophen-3-yl-2-pyridinyl)-4-methylpiperazine (PubChem CID 68620387) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is but-2-enedioic acid;1-(6-cyclohexyl-4-thiophen-3-yl-2-pyridinyl)-4-methylpiperazine.
| Compound Name | but-2-enedioic acid;1-(6-cyclohexyl-4-thiophen-3-yl-2-pyridinyl)-4-methylpiperazine |
|---|---|
| PubChem CID | 68620387 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | but-2-enedioic acid;1-(6-cyclohexyl-4-thiophen-3-yl-2-pyridinyl)-4-methylpiperazine |
| SMILES | CN1CCN(c2cc(-c3ccsc3)cc(C3CCCCC3)n2)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C20H27N3S.C4H4O4/c1-22-8-10-23(11-9-22)20-14-18(17-7-12-24-15-17)13-19(21-20)16-5-3-2-4-6-16;5-3(6)1-2-4(7)8/h7,12-16H,2-6,8-11H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | JCXUQDLGZILDKF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|