C20H31N3O — CID 67698077
6-[[3-(1-pyrrolidin-2-ylethyl)-1H-indol-5-yl]oxy]hexan-1-amine (PubChem CID 67698077) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is 6-[[3-(1-pyrrolidin-2-ylethyl)-1H-indol-5-yl]oxy]hexan-1-amine.
| Compound Name | 6-[[3-(1-pyrrolidin-2-ylethyl)-1H-indol-5-yl]oxy]hexan-1-amine |
|---|---|
| PubChem CID | 67698077 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | 6-[[3-(1-pyrrolidin-2-ylethyl)-1H-indol-5-yl]oxy]hexan-1-amine |
| SMILES | CC(c1c[nH]c2ccc(OCCCCCCN)cc12)C1CCCN1 |
| InChI | InChI=1S/C20H31N3O/c1-15(19-7-6-11-22-19)18-14-23-20-9-8-16(13-17(18)20)24-12-5-3-2-4-10-21/h8-9,13-15,19,22-23H,2-7,10-12,21H2,1H3 |
| InChIKey | UXWVLYNJPIKCCI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|