C24H18N2O5S — CID 67703404
5-(benzenesulfinyl)-2-(3-carboxy-4-phenylphenyl)-3-methylimidazole-4-carboxylic acid (PubChem CID 67703404) has the molecular formula C24H18N2O5S and a molecular weight of 446.48 g/mol. Its IUPAC name is 5-(benzenesulfinyl)-2-(3-carboxy-4-phenylphenyl)-3-methylimidazole-4-carboxylic acid.
| Compound Name | 5-(benzenesulfinyl)-2-(3-carboxy-4-phenylphenyl)-3-methylimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 67703404 |
| Molecular Formula | C24H18N2O5S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 5-(benzenesulfinyl)-2-(3-carboxy-4-phenylphenyl)-3-methylimidazole-4-carboxylic acid |
| SMILES | Cn1c(-c2ccc(-c3ccccc3)c(C(=O)O)c2)nc(S(=O)c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C24H18N2O5S/c1-26-20(24(29)30)22(32(31)17-10-6-3-7-11-17)25-21(26)16-12-13-18(19(14-16)23(27)28)15-8-4-2-5-9-15/h2-14H,1H3,(H,27,28)(H,29,30) |
| InChIKey | VUPSNCCNPBBFKX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |