About 3-hydroxypropyl 3-amino-2-nitrobenzoate
3-hydroxypropyl 3-amino-2-nitrobenzoate (PubChem CID 67708329) has the molecular formula C10H12N2O5
and a molecular weight of 240.22 g/mol. Its IUPAC name is 3-hydroxypropyl 3-amino-2-nitrobenzoate.
Molecular Properties
| Compound Name | 3-hydroxypropyl 3-amino-2-nitrobenzoate |
| PubChem CID | 67708329 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 3-hydroxypropyl 3-amino-2-nitrobenzoate |
| SMILES | Nc1cccc(C(=O)OCCCO)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12N2O5/c11-8-4-1-3-7(9(8)12(15)16)10(14)17-6-2-5-13/h1,3-4,13H,2,5-6,11H2 |
| InChIKey | UQUMANRQRVLIHS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxypropyl 3-amino-2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypropyl 3-amino-2-nitrobenzoate?
The IUPAC name of 3-hydroxypropyl 3-amino-2-nitrobenzoate (CID 67708329) is 3-hydroxypropyl 3-amino-2-nitrobenzoate.
What is the SMILES notation for 3-hydroxypropyl 3-amino-2-nitrobenzoate?
The canonical SMILES for 3-hydroxypropyl 3-amino-2-nitrobenzoate is Nc1cccc(C(=O)OCCCO)c1[N+](=O)[O-].
What is the InChIKey of 3-hydroxypropyl 3-amino-2-nitrobenzoate?
The InChIKey is UQUMANRQRVLIHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O5/c11-8-4-1-3-7(9(8)12(15)16)10(14)17-6-2-5-13/h1,3-4,13H,2,5-6,11H2.
What are the key properties of 3-hydroxypropyl 3-amino-2-nitrobenzoate?
3-hydroxypropyl 3-amino-2-nitrobenzoate has a molecular weight of 240.22 g/mol, XLogP of 0.72, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypropyl 3-amino-2-nitrobenzoate is sourced from PubChem (CID 67708329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).