C32H39Cl3N6O3 — CID 67708588
5-[(4-chlorophenyl)methyl]-2,2-dimethyl-1-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-ol;1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole (PubChem CID 67708588) has the molecular formula C32H39Cl3N6O3 and a molecular weight of 662.06 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methyl]-2,2-dimethyl-1-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-ol;1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 5-[(4-chlorophenyl)methyl]-2,2-dimethyl-1-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-ol;1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 67708588 |
| Molecular Formula | C32H39Cl3N6O3 |
| Molecular Weight | 662.06 g/mol |
| Exact Mass | 660.21 |
| IUPAC Name | 5-[(4-chlorophenyl)methyl]-2,2-dimethyl-1-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-ol;1-[[2-(2,4-dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl]methyl]-1,2,4-triazole |
| SMILES | CC1(C)CCC(Cc2ccc(Cl)cc2)C1(O)Cn1cncn1.CCCC1COC(Cn2cncn2)(c2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C17H22ClN3O.C15H17Cl2N3O2/c1-16(2)8-7-14(9-13-3-5-15(18)6-4-13)17(16,22)10-21-12-19-11-20-21;1-2-3-12-7-21-15(22-12,8-20-10-18-9-19-20)13-5-4-11(16)6-14(13)17/h3-6,11-12,14,22H,7-10H2,1-2H3;4-6,9-10,12H,2-3,7-8H2,1H3 |
| InChIKey | SKOGFLWAMGPJAM-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.06 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |