C36H46F2O4 — CID 67709694
2,3-difluoro-4-octylbenzoic acid;1-[2-(4-hydroxyphenyl)phenyl]nonan-1-one (PubChem CID 67709694) has the molecular formula C36H46F2O4 and a molecular weight of 580.76 g/mol. Its IUPAC name is 2,3-difluoro-4-octylbenzoic acid;1-[2-(4-hydroxyphenyl)phenyl]nonan-1-one.
| Compound Name | 2,3-difluoro-4-octylbenzoic acid;1-[2-(4-hydroxyphenyl)phenyl]nonan-1-one |
|---|---|
| PubChem CID | 67709694 |
| Molecular Formula | C36H46F2O4 |
| Molecular Weight | 580.76 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | 2,3-difluoro-4-octylbenzoic acid;1-[2-(4-hydroxyphenyl)phenyl]nonan-1-one |
| SMILES | CCCCCCCCC(=O)c1ccccc1-c1ccc(O)cc1.CCCCCCCCc1ccc(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C21H26O2.C15H20F2O2/c1-2-3-4-5-6-7-12-21(23)20-11-9-8-10-19(20)17-13-15-18(22)16-14-17;1-2-3-4-5-6-7-8-11-9-10-12(15(18)19)14(17)13(11)16/h8-11,13-16,22H,2-7,12H2,1H3;9-10H,2-8H2,1H3,(H,18,19) |
| InChIKey | OFYXWMNNNWIRMU-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.76 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|