C17H22O2 — CID 67714108
(2S)-2-but-2-enyl-6-(2-methylpropoxy)-2,3-dihydroinden-1-one (PubChem CID 67714108) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (2S)-2-but-2-enyl-6-(2-methylpropoxy)-2,3-dihydroinden-1-one.
| Compound Name | (2S)-2-but-2-enyl-6-(2-methylpropoxy)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 67714108 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (2S)-2-but-2-enyl-6-(2-methylpropoxy)-2,3-dihydroinden-1-one |
| SMILES | CC=CC[C@H]1Cc2ccc(OCC(C)C)cc2C1=O |
| InChI | InChI=1S/C17H22O2/c1-4-5-6-14-9-13-7-8-15(19-11-12(2)3)10-16(13)17(14)18/h4-5,7-8,10,12,14H,6,9,11H2,1-3H3/t14-/m0/s1 |
| InChIKey | UVRUJADVKDDMGP-AWEZNQCLSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|