C14H16O — CID 67713899
(2S)-2-but-2-enyl-6-methyl-2,3-dihydroinden-1-one (PubChem CID 67713899) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is (2S)-2-but-2-enyl-6-methyl-2,3-dihydroinden-1-one.
| Compound Name | (2S)-2-but-2-enyl-6-methyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 67713899 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (2S)-2-but-2-enyl-6-methyl-2,3-dihydroinden-1-one |
| SMILES | CC=CC[C@H]1Cc2ccc(C)cc2C1=O |
| InChI | InChI=1S/C14H16O/c1-3-4-5-12-9-11-7-6-10(2)8-13(11)14(12)15/h3-4,6-8,12H,5,9H2,1-2H3/t12-/m0/s1 |
| InChIKey | LGMKWGLTRWSRMR-LBPRGKRZSA-N |
| XLogP | 3.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|