C22H19Cl2FN2O3 — CID 67717933
N-(3,5-dichloro-4-pyridinyl)-4-methoxy-3-(2-phenylmethoxyethoxy)benzenecarboximidoyl fluoride (PubChem CID 67717933) has the molecular formula C22H19Cl2FN2O3 and a molecular weight of 449.31 g/mol. Its IUPAC name is N-(3,5-dichloro-4-pyridinyl)-4-methoxy-3-(2-phenylmethoxyethoxy)benzenecarboximidoyl fluoride.
| Compound Name | N-(3,5-dichloro-4-pyridinyl)-4-methoxy-3-(2-phenylmethoxyethoxy)benzenecarboximidoyl fluoride |
|---|---|
| PubChem CID | 67717933 |
| Molecular Formula | C22H19Cl2FN2O3 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-(3,5-dichloro-4-pyridinyl)-4-methoxy-3-(2-phenylmethoxyethoxy)benzenecarboximidoyl fluoride |
| SMILES | COc1ccc(/C(F)=N/c2c(Cl)cncc2Cl)cc1OCCOCc1ccccc1 |
| InChI | InChI=1S/C22H19Cl2FN2O3/c1-28-19-8-7-16(22(25)27-21-17(23)12-26-13-18(21)24)11-20(19)30-10-9-29-14-15-5-3-2-4-6-15/h2-8,11-13H,9-10,14H2,1H3/b27-22- |
| InChIKey | OPWVQQMQUSWFOB-QYQHSDTDSA-N |
| XLogP | 6.04 |
| TPSA | 52.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|