C20H17N3O4S2 — CID 67724225
4-[4-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]benzoyl]-1,3-thiazolidine-2,5-dione (PubChem CID 67724225) has the molecular formula C20H17N3O4S2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 4-[4-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]benzoyl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[4-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]benzoyl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 67724225 |
| Molecular Formula | C20H17N3O4S2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 4-[4-[2-[1,3-benzothiazol-2-yl(methyl)amino]ethoxy]benzoyl]-1,3-thiazolidine-2,5-dione |
| SMILES | CN(CCOc1ccc(C(=O)C2NC(=O)SC2=O)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H17N3O4S2/c1-23(19-21-14-4-2-3-5-15(14)28-19)10-11-27-13-8-6-12(7-9-13)17(24)16-18(25)29-20(26)22-16/h2-9,16H,10-11H2,1H3,(H,22,26) |
| InChIKey | YQTYBBUFHLJWHO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|