C56H78F4O — CID 67725054
4-[4-[[4-(3,4-difluorophenyl)-4-(1-nonylcyclohexyl)cyclohexa-2,5-dien-1-yl]methoxymethyl]-1-(1-nonylcyclohexyl)cyclohexa-2,5-dien-1-yl]-1,2-difluorobenzene (PubChem CID 67725054) has the molecular formula C56H78F4O and a molecular weight of 843.23 g/mol. Its IUPAC name is 4-[4-[[4-(3,4-difluorophenyl)-4-(1-nonylcyclohexyl)cyclohexa-2,5-dien-1-yl]methoxymethyl]-1-(1-nonylcyclohexyl)cyclohexa-2,5-dien-1-yl]-1,2-difluorobenzene.
| Compound Name | 4-[4-[[4-(3,4-difluorophenyl)-4-(1-nonylcyclohexyl)cyclohexa-2,5-dien-1-yl]methoxymethyl]-1-(1-nonylcyclohexyl)cyclohexa-2,5-dien-1-yl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 67725054 |
| Molecular Formula | C56H78F4O |
| Molecular Weight | 843.23 g/mol |
| Exact Mass | 842.60 |
| IUPAC Name | 4-[4-[[4-(3,4-difluorophenyl)-4-(1-nonylcyclohexyl)cyclohexa-2,5-dien-1-yl]methoxymethyl]-1-(1-nonylcyclohexyl)cyclohexa-2,5-dien-1-yl]-1,2-difluorobenzene |
| SMILES | CCCCCCCCCC1(C2(c3ccc(F)c(F)c3)C=CC(COCC3C=CC(c4ccc(F)c(F)c4)(C4(CCCCCCCCC)CCCCC4)C=C3)C=C2)CCCCC1 |
| InChI | InChI=1S/C56H78F4O/c1-3-5-7-9-11-13-17-31-53(33-19-15-20-34-53)55(47-23-25-49(57)51(59)41-47)37-27-45(28-38-55)43-61-44-46-29-39-56(40-30-46,48-24-26-50(58)52(60)42-48)54(35-21-16-22-36-54)32-18-14-12-10-8-6-4-2/h23-30,37-42,45-46H,3-22,31-36,43-44H2,1-2H3 |
| InChIKey | ZYKJJRSHOSTZKR-UHFFFAOYSA-N |
| XLogP | 17.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.23 |
| LogP ≤ 5 | 17.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|