C25H37NO3 — CID 67732056
(8R,9R,10R,13S,14S)-17-butyl-17-carbamoyl-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid (PubChem CID 67732056) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-17-butyl-17-carbamoyl-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid.
| Compound Name | (8R,9R,10R,13S,14S)-17-butyl-17-carbamoyl-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid |
|---|---|
| PubChem CID | 67732056 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | (8R,9R,10R,13S,14S)-17-butyl-17-carbamoyl-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-3-carboxylic acid |
| SMILES | CCCCC1(C(N)=O)CC[C@H]2[C@@H]3CC=C4C=C(C(=O)O)CC[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C25H37NO3/c1-4-5-11-25(22(26)29)14-10-20-18-7-6-17-15-16(21(27)28)8-12-23(17,2)19(18)9-13-24(20,25)3/h6,15,18-20H,4-5,7-14H2,1-3H3,(H2,26,29)(H,27,28)/t18-,19-,20+,23+,24+,25?/m1/s1 |
| InChIKey | LRKPFAXLSWHVRP-OHZFXUHLSA-N |
| XLogP | 5.23 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |