About 2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide
2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide (PubChem CID 67732618) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide.
Molecular Properties
| Compound Name | 2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide |
| PubChem CID | 67732618 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide |
| SMILES | C=C(C)C(=O)NNCCCCc1ccccc1 |
| InChI | InChI=1S/C14H20N2O/c1-12(2)14(17)16-15-11-7-6-10-13-8-4-3-5-9-13/h3-5,8-9,15H,1,6-7,10-11H2,2H3,(H,16,17) |
| InChIKey | XWHJUTJQBQBZNS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide?
The IUPAC name of 2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide (CID 67732618) is 2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide.
What is the SMILES notation for 2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide?
The canonical SMILES for 2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide is C=C(C)C(=O)NNCCCCc1ccccc1.
What is the InChIKey of 2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide?
The InChIKey is XWHJUTJQBQBZNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O/c1-12(2)14(17)16-15-11-7-6-10-13-8-4-3-5-9-13/h3-5,8-9,15H,1,6-7,10-11H2,2H3,(H,16,17).
What are the key properties of 2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide?
2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide has a molecular weight of 232.33 g/mol, XLogP of 2.21, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N'-(4-phenylbutyl)prop-2-enehydrazide is sourced from PubChem (CID 67732618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).