C19H21N2O3+ — CID 67737268
2-methyl-2-(2-oxo-3,3-diphenylimidazolidin-3-ium-1-yl)propanoic acid (PubChem CID 67737268) has the molecular formula C19H21N2O3+ and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-methyl-2-(2-oxo-3,3-diphenylimidazolidin-3-ium-1-yl)propanoic acid.
| Compound Name | 2-methyl-2-(2-oxo-3,3-diphenylimidazolidin-3-ium-1-yl)propanoic acid |
|---|---|
| PubChem CID | 67737268 |
| Molecular Formula | C19H21N2O3+ |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-methyl-2-(2-oxo-3,3-diphenylimidazolidin-3-ium-1-yl)propanoic acid |
| SMILES | CC(C)(C(=O)O)N1CC[N+](c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H20N2O3/c1-19(2,17(22)23)20-13-14-21(18(20)24,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3/p+1 |
| InChIKey | VBEHEKDTYKAWQY-UHFFFAOYSA-O |
| XLogP | 3.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|