C18H20ClNO3 — CID 67740469
2-chloroethyl 2-[2-(3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl)ethynyl]benzoate (PubChem CID 67740469) has the molecular formula C18H20ClNO3 and a molecular weight of 333.82 g/mol. Its IUPAC name is 2-chloroethyl 2-[2-(3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl)ethynyl]benzoate.
| Compound Name | 2-chloroethyl 2-[2-(3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl)ethynyl]benzoate |
|---|---|
| PubChem CID | 67740469 |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 2-chloroethyl 2-[2-(3-hydroxy-1-azabicyclo[2.2.2]octan-3-yl)ethynyl]benzoate |
| SMILES | O=C(OCCCl)c1ccccc1C#CC1(O)CN2CCC1CC2 |
| InChI | InChI=1S/C18H20ClNO3/c19-9-12-23-17(21)16-4-2-1-3-14(16)5-8-18(22)13-20-10-6-15(18)7-11-20/h1-4,15,22H,6-7,9-13H2 |
| InChIKey | RMIYNQGHAJZNHI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|