C17H21F2N5OSi — CID 67743835
[2-(2,4-difluorophenyl)-1-(1H-imidazol-2-yl)-3-(1,2,4-triazol-1-yl)propan-2-yl]oxy-trimethylsilane (PubChem CID 67743835) has the molecular formula C17H21F2N5OSi and a molecular weight of 377.47 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)-1-(1H-imidazol-2-yl)-3-(1,2,4-triazol-1-yl)propan-2-yl]oxy-trimethylsilane.
| Compound Name | [2-(2,4-difluorophenyl)-1-(1H-imidazol-2-yl)-3-(1,2,4-triazol-1-yl)propan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 67743835 |
| Molecular Formula | C17H21F2N5OSi |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | [2-(2,4-difluorophenyl)-1-(1H-imidazol-2-yl)-3-(1,2,4-triazol-1-yl)propan-2-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC(Cc1ncc[nH]1)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H21F2N5OSi/c1-26(2,3)25-17(9-16-21-6-7-22-16,10-24-12-20-11-23-24)14-5-4-13(18)8-15(14)19/h4-8,11-12H,9-10H2,1-3H3,(H,21,22) |
| InChIKey | OEUAMFPWBIQQOC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|