About ethenylazanium;phthalate
ethenylazanium;phthalate (PubChem CID 67748606) has the molecular formula C12H16N2O4
and a molecular weight of 252.27 g/mol. Its IUPAC name is ethenylazanium;phthalate.
Molecular Properties
| Compound Name | ethenylazanium;phthalate |
| PubChem CID | 67748606 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | ethenylazanium;phthalate |
| SMILES | C=C[NH3+].C=C[NH3+].O=C([O-])c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C8H6O4.2C2H5N/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-2-3/h1-4H,(H,9,10)(H,11,12);2*2H,1,3H2 |
| InChIKey | JEJAXNWSHWWYIJ-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethenylazanium;phthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenylazanium;phthalate?
The IUPAC name of ethenylazanium;phthalate (CID 67748606) is ethenylazanium;phthalate.
What is the SMILES notation for ethenylazanium;phthalate?
The canonical SMILES for ethenylazanium;phthalate is C=C[NH3+].C=C[NH3+].O=C([O-])c1ccccc1C(=O)[O-].
What is the InChIKey of ethenylazanium;phthalate?
The InChIKey is JEJAXNWSHWWYIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.2C2H5N/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-2-3/h1-4H,(H,9,10)(H,11,12);2*2H,1,3H2.
What are the key properties of ethenylazanium;phthalate?
ethenylazanium;phthalate has a molecular weight of 252.27 g/mol, XLogP of -2.84, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylazanium;phthalate is sourced from PubChem (CID 67748606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).