C23H28ClNO5 — CID 67750840
(2E)-2-[(4-methoxy-2,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]-8-pyridin-3-yloctanoic acid;hydrochloride (PubChem CID 67750840) has the molecular formula C23H28ClNO5 and a molecular weight of 433.93 g/mol. Its IUPAC name is (2E)-2-[(4-methoxy-2,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]-8-pyridin-3-yloctanoic acid;hydrochloride.
| Compound Name | (2E)-2-[(4-methoxy-2,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]-8-pyridin-3-yloctanoic acid;hydrochloride |
|---|---|
| PubChem CID | 67750840 |
| Molecular Formula | C23H28ClNO5 |
| Molecular Weight | 433.93 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (2E)-2-[(4-methoxy-2,5-dimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]-8-pyridin-3-yloctanoic acid;hydrochloride |
| SMILES | COC1=C(C)C(=O)C(/C=C(\CCCCCCc2cccnc2)C(=O)O)=C(C)C1=O.Cl |
| InChI | InChI=1S/C23H27NO5.ClH/c1-15-19(20(25)16(2)22(29-3)21(15)26)13-18(23(27)28)11-7-5-4-6-9-17-10-8-12-24-14-17;/h8,10,12-14H,4-7,9,11H2,1-3H3,(H,27,28);1H/b18-13+; |
| InChIKey | ITRAMZOHLZYXKL-PUBYZPQMSA-N |
| XLogP | 4.40 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.93 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|