C25H31NO6 — CID 139622182
(2E)-2-[[6-methoxy-5-(methoxymethoxy)-4-methyl-2,3-dihydro-1-benzofuran-7-yl]methylidene]-7-pyridin-3-ylheptanoic acid (PubChem CID 139622182) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is (2E)-2-[[6-methoxy-5-(methoxymethoxy)-4-methyl-2,3-dihydro-1-benzofuran-7-yl]methylidene]-7-pyridin-3-ylheptanoic acid.
| Compound Name | (2E)-2-[[6-methoxy-5-(methoxymethoxy)-4-methyl-2,3-dihydro-1-benzofuran-7-yl]methylidene]-7-pyridin-3-ylheptanoic acid |
|---|---|
| PubChem CID | 139622182 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | (2E)-2-[[6-methoxy-5-(methoxymethoxy)-4-methyl-2,3-dihydro-1-benzofuran-7-yl]methylidene]-7-pyridin-3-ylheptanoic acid |
| SMILES | COCOc1c(C)c2c(c(/C=C(\CCCCCc3cccnc3)C(=O)O)c1OC)OCC2 |
| InChI | InChI=1S/C25H31NO6/c1-17-20-11-13-31-23(20)21(24(30-3)22(17)32-16-29-2)14-19(25(27)28)10-6-4-5-8-18-9-7-12-26-15-18/h7,9,12,14-15H,4-6,8,10-11,13,16H2,1-3H3,(H,27,28)/b19-14+ |
| InChIKey | KEYQUVKAVZDZSR-XMHGGMMESA-N |
| XLogP | 4.59 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|