C23H29NO5 — CID 10573010
(2E)-6-pyridin-3-yl-2-[(2,4,5-trimethoxy-3,6-dimethylphenyl)methylidene]hexanoic acid (PubChem CID 10573010) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is (2E)-6-pyridin-3-yl-2-[(2,4,5-trimethoxy-3,6-dimethylphenyl)methylidene]hexanoic acid.
| Compound Name | (2E)-6-pyridin-3-yl-2-[(2,4,5-trimethoxy-3,6-dimethylphenyl)methylidene]hexanoic acid |
|---|---|
| PubChem CID | 10573010 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (2E)-6-pyridin-3-yl-2-[(2,4,5-trimethoxy-3,6-dimethylphenyl)methylidene]hexanoic acid |
| SMILES | COc1c(C)c(OC)c(OC)c(C)c1/C=C(\CCCCc1cccnc1)C(=O)O |
| InChI | InChI=1S/C23H29NO5/c1-15-19(20(27-3)16(2)22(29-5)21(15)28-4)13-18(23(25)26)11-7-6-9-17-10-8-12-24-14-17/h8,10,12-14H,6-7,9,11H2,1-5H3,(H,25,26)/b18-13+ |
| InChIKey | PIYATBRWRHPDBY-QGOAFFKASA-N |
| XLogP | 4.61 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|