C10H13FN2O4 — CID 67751450
1-[2-fluoro-3,4-bis(hydroxymethyl)cyclobutyl]pyrimidine-2,4-dione (PubChem CID 67751450) has the molecular formula C10H13FN2O4 and a molecular weight of 244.22 g/mol. Its IUPAC name is 1-[2-fluoro-3,4-bis(hydroxymethyl)cyclobutyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-fluoro-3,4-bis(hydroxymethyl)cyclobutyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67751450 |
| Molecular Formula | C10H13FN2O4 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 1-[2-fluoro-3,4-bis(hydroxymethyl)cyclobutyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(C2C(F)C(CO)C2CO)c(=O)[nH]1 |
| InChI | InChI=1S/C10H13FN2O4/c11-8-5(3-14)6(4-15)9(8)13-2-1-7(16)12-10(13)17/h1-2,5-6,8-9,14-15H,3-4H2,(H,12,16,17) |
| InChIKey | JADIUCVQXRIEFD-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |