C37H41N5O5S — CID 67756950
[2-[4-[[2-butyl-6-[[2-(butylamino)-2-oxoethyl]amino]benzimidazol-1-yl]methyl]phenyl]phenyl] N-(benzenesulfonyl)carbamate (PubChem CID 67756950) has the molecular formula C37H41N5O5S and a molecular weight of 667.83 g/mol. Its IUPAC name is [2-[4-[[2-butyl-6-[[2-(butylamino)-2-oxoethyl]amino]benzimidazol-1-yl]methyl]phenyl]phenyl] N-(benzenesulfonyl)carbamate.
| Compound Name | [2-[4-[[2-butyl-6-[[2-(butylamino)-2-oxoethyl]amino]benzimidazol-1-yl]methyl]phenyl]phenyl] N-(benzenesulfonyl)carbamate |
|---|---|
| PubChem CID | 67756950 |
| Molecular Formula | C37H41N5O5S |
| Molecular Weight | 667.83 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | [2-[4-[[2-butyl-6-[[2-(butylamino)-2-oxoethyl]amino]benzimidazol-1-yl]methyl]phenyl]phenyl] N-(benzenesulfonyl)carbamate |
| SMILES | CCCCNC(=O)CNc1ccc2nc(CCCC)n(Cc3ccc(-c4ccccc4OC(=O)NS(=O)(=O)c4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C37H41N5O5S/c1-3-5-16-35-40-32-22-21-29(39-25-36(43)38-23-6-4-2)24-33(32)42(35)26-27-17-19-28(20-18-27)31-14-10-11-15-34(31)47-37(44)41-48(45,46)30-12-8-7-9-13-30/h7-15,17-22,24,39H,3-6,16,23,25-26H2,1-2H3,(H,38,43)(H,41,44) |
| InChIKey | PRBJKFSOLBLFPX-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.83 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|