C26H27N3O — CID 67757232
1-[4-(4-benzyl-4,5-diazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-2-yl)-3,6-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 67757232) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-[4-(4-benzyl-4,5-diazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-2-yl)-3,6-dihydro-2H-pyridin-1-yl]ethanone.
| Compound Name | 1-[4-(4-benzyl-4,5-diazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-2-yl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 67757232 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 1-[4-(4-benzyl-4,5-diazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),5,10,12-pentaen-2-yl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | CC(=O)N1CC=C(C2c3ccccc3CCc3cnn(Cc4ccccc4)c32)CC1 |
| InChI | InChI=1S/C26H27N3O/c1-19(30)28-15-13-22(14-16-28)25-24-10-6-5-9-21(24)11-12-23-17-27-29(26(23)25)18-20-7-3-2-4-8-20/h2-10,13,17,25H,11-12,14-16,18H2,1H3 |
| InChIKey | SXGAAXADSLEVBG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|