C11H20N2O4 — CID 67758323
[(3S,4S)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl] formate (PubChem CID 67758323) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is [(3S,4S)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl] formate.
| Compound Name | [(3S,4S)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl] formate |
|---|---|
| PubChem CID | 67758323 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | [(3S,4S)-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidin-1-yl] formate |
| SMILES | C[C@H]1CN(OC=O)C[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H20N2O4/c1-8-5-13(16-7-14)6-9(8)12-10(15)17-11(2,3)4/h7-9H,5-6H2,1-4H3,(H,12,15)/t8-,9+/m0/s1 |
| InChIKey | HAJOOZVYYOGEPG-DTWKUNHWSA-N |
| XLogP | 0.92 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|