C30H23N6O3S+ — CID 67759064
2-[3-quinolin-8-yl-5-(3,4,5-trimethoxyphenyl)tetrazol-2-ium-2-yl]benzo[e][1,3]benzothiazole (PubChem CID 67759064) has the molecular formula C30H23N6O3S+ and a molecular weight of 547.62 g/mol. Its IUPAC name is 2-[3-quinolin-8-yl-5-(3,4,5-trimethoxyphenyl)tetrazol-2-ium-2-yl]benzo[e][1,3]benzothiazole.
| Compound Name | 2-[3-quinolin-8-yl-5-(3,4,5-trimethoxyphenyl)tetrazol-2-ium-2-yl]benzo[e][1,3]benzothiazole |
|---|---|
| PubChem CID | 67759064 |
| Molecular Formula | C30H23N6O3S+ |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 2-[3-quinolin-8-yl-5-(3,4,5-trimethoxyphenyl)tetrazol-2-ium-2-yl]benzo[e][1,3]benzothiazole |
| SMILES | COc1cc(-c2nn(-c3cccc4cccnc34)[n+](-c3nc4c(ccc5ccccc54)s3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C30H23N6O3S/c1-37-23-16-20(17-24(38-2)28(23)39-3)29-33-35(22-12-6-9-19-10-7-15-31-26(19)22)36(34-29)30-32-27-21-11-5-4-8-18(21)13-14-25(27)40-30/h4-17H,1-3H3/q+1 |
| InChIKey | AHLIEORJRKBYHO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 88.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|