C15H21N5O2 — CID 67777210
tert-butyl N-[cyclopropyl(methyl)amino]-N-([1,2,4]triazolo[1,5-a]pyridin-7-yl)carbamate (PubChem CID 67777210) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is tert-butyl N-[cyclopropyl(methyl)amino]-N-([1,2,4]triazolo[1,5-a]pyridin-7-yl)carbamate.
| Compound Name | tert-butyl N-[cyclopropyl(methyl)amino]-N-([1,2,4]triazolo[1,5-a]pyridin-7-yl)carbamate |
|---|---|
| PubChem CID | 67777210 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | tert-butyl N-[cyclopropyl(methyl)amino]-N-([1,2,4]triazolo[1,5-a]pyridin-7-yl)carbamate |
| SMILES | CN(C1CC1)N(C(=O)OC(C)(C)C)c1ccn2ncnc2c1 |
| InChI | InChI=1S/C15H21N5O2/c1-15(2,3)22-14(21)20(18(4)11-5-6-11)12-7-8-19-13(9-12)16-10-17-19/h7-11H,5-6H2,1-4H3 |
| InChIKey | LHYPJAOTKKDXIM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|