C16H23BN4O6 — CID 176759154
[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]boronic acid (PubChem CID 176759154) has the molecular formula C16H23BN4O6 and a molecular weight of 378.19 g/mol. Its IUPAC name is [4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]boronic acid.
| Compound Name | [4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]boronic acid |
|---|---|
| PubChem CID | 176759154 |
| Molecular Formula | C16H23BN4O6 |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | [4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolo[2,1-f][1,2,4]triazin-5-yl]boronic acid |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1ncnn2ccc(B(O)O)c12 |
| InChI | InChI=1S/C16H23BN4O6/c1-15(2,3)26-13(22)21(14(23)27-16(4,5)6)12-11-10(17(24)25)7-8-20(11)19-9-18-12/h7-9,24-25H,1-6H3 |
| InChIKey | IIZPLYDUHBRFHK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|