C18H17N3O4 — CID 67780753
N-[(1,3-dioxoisoindol-2-yl)methyl]-N-ethenyl-2-(2-oxopyrrolidin-1-yl)prop-2-enamide (PubChem CID 67780753) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is N-[(1,3-dioxoisoindol-2-yl)methyl]-N-ethenyl-2-(2-oxopyrrolidin-1-yl)prop-2-enamide.
| Compound Name | N-[(1,3-dioxoisoindol-2-yl)methyl]-N-ethenyl-2-(2-oxopyrrolidin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 67780753 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | N-[(1,3-dioxoisoindol-2-yl)methyl]-N-ethenyl-2-(2-oxopyrrolidin-1-yl)prop-2-enamide |
| SMILES | C=CN(CN1C(=O)c2ccccc2C1=O)C(=O)C(=C)N1CCCC1=O |
| InChI | InChI=1S/C18H17N3O4/c1-3-19(16(23)12(2)20-10-6-9-15(20)22)11-21-17(24)13-7-4-5-8-14(13)18(21)25/h3-5,7-8H,1-2,6,9-11H2 |
| InChIKey | KBLQMKAFWUKJKP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|