C34H45NO5 — CID 67781934
3-[4-[3-(1-adamantyl)decoxy]benzoyl]oxy-4-aminobenzoic acid (PubChem CID 67781934) has the molecular formula C34H45NO5 and a molecular weight of 547.74 g/mol. Its IUPAC name is 3-[4-[3-(1-adamantyl)decoxy]benzoyl]oxy-4-aminobenzoic acid.
| Compound Name | 3-[4-[3-(1-adamantyl)decoxy]benzoyl]oxy-4-aminobenzoic acid |
|---|---|
| PubChem CID | 67781934 |
| Molecular Formula | C34H45NO5 |
| Molecular Weight | 547.74 g/mol |
| Exact Mass | 547.33 |
| IUPAC Name | 3-[4-[3-(1-adamantyl)decoxy]benzoyl]oxy-4-aminobenzoic acid |
| SMILES | CCCCCCCC(CCOc1ccc(C(=O)Oc2cc(C(=O)O)ccc2N)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C34H45NO5/c1-2-3-4-5-6-7-28(34-20-23-16-24(21-34)18-25(17-23)22-34)14-15-39-29-11-8-26(9-12-29)33(38)40-31-19-27(32(36)37)10-13-30(31)35/h8-13,19,23-25,28H,2-7,14-18,20-22,35H2,1H3,(H,36,37) |
| InChIKey | XTPLFBKHBVNZGJ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.74 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|