About 4-(3-butoxy-1,1-difluoropropan-2-yl)phenol
4-(3-butoxy-1,1-difluoropropan-2-yl)phenol (PubChem CID 67785021) has the molecular formula C13H18F2O2
and a molecular weight of 244.28 g/mol. Its IUPAC name is 4-(3-butoxy-1,1-difluoropropan-2-yl)phenol.
Molecular Properties
| Compound Name | 4-(3-butoxy-1,1-difluoropropan-2-yl)phenol |
| PubChem CID | 67785021 |
| Molecular Formula | C13H18F2O2 |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-(3-butoxy-1,1-difluoropropan-2-yl)phenol |
| SMILES | CCCCOCC(c1ccc(O)cc1)C(F)F |
| InChI | InChI=1S/C13H18F2O2/c1-2-3-8-17-9-12(13(14)15)10-4-6-11(16)7-5-10/h4-7,12-13,16H,2-3,8-9H2,1H3 |
| InChIKey | IVPDGLBCRZQQMB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-butoxy-1,1-difluoropropan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-butoxy-1,1-difluoropropan-2-yl)phenol?
The IUPAC name of 4-(3-butoxy-1,1-difluoropropan-2-yl)phenol (CID 67785021) is 4-(3-butoxy-1,1-difluoropropan-2-yl)phenol.
What is the SMILES notation for 4-(3-butoxy-1,1-difluoropropan-2-yl)phenol?
The canonical SMILES for 4-(3-butoxy-1,1-difluoropropan-2-yl)phenol is CCCCOCC(c1ccc(O)cc1)C(F)F.
What is the InChIKey of 4-(3-butoxy-1,1-difluoropropan-2-yl)phenol?
The InChIKey is IVPDGLBCRZQQMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2O2/c1-2-3-8-17-9-12(13(14)15)10-4-6-11(16)7-5-10/h4-7,12-13,16H,2-3,8-9H2,1H3.
What are the key properties of 4-(3-butoxy-1,1-difluoropropan-2-yl)phenol?
4-(3-butoxy-1,1-difluoropropan-2-yl)phenol has a molecular weight of 244.28 g/mol, XLogP of 3.56, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-butoxy-1,1-difluoropropan-2-yl)phenol is sourced from PubChem (CID 67785021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).