C16H21N3O4S — CID 67786868
N-[2-(6-methoxy-3-oxido-1,3-benzothiazol-3-ium-2-yl)ethyl]-2-morpholin-4-ylacetamide (PubChem CID 67786868) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-[2-(6-methoxy-3-oxido-1,3-benzothiazol-3-ium-2-yl)ethyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[2-(6-methoxy-3-oxido-1,3-benzothiazol-3-ium-2-yl)ethyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 67786868 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[2-(6-methoxy-3-oxido-1,3-benzothiazol-3-ium-2-yl)ethyl]-2-morpholin-4-ylacetamide |
| SMILES | COc1ccc2c(c1)sc(CCNC(=O)CN1CCOCC1)[n+]2[O-] |
| InChI | InChI=1S/C16H21N3O4S/c1-22-12-2-3-13-14(10-12)24-16(19(13)21)4-5-17-15(20)11-18-6-8-23-9-7-18/h2-3,10H,4-9,11H2,1H3,(H,17,20) |
| InChIKey | MJKCLJMWDGQEMA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|