C16H32N6O6 — CID 67788052
2-ethylhexyl N-[3,5-bis(methoxycarbonylamino)-1,3,5-triazinan-1-yl]carbamate (PubChem CID 67788052) has the molecular formula C16H32N6O6 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-ethylhexyl N-[3,5-bis(methoxycarbonylamino)-1,3,5-triazinan-1-yl]carbamate.
| Compound Name | 2-ethylhexyl N-[3,5-bis(methoxycarbonylamino)-1,3,5-triazinan-1-yl]carbamate |
|---|---|
| PubChem CID | 67788052 |
| Molecular Formula | C16H32N6O6 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 2-ethylhexyl N-[3,5-bis(methoxycarbonylamino)-1,3,5-triazinan-1-yl]carbamate |
| SMILES | CCCCC(CC)COC(=O)NN1CN(NC(=O)OC)CN(NC(=O)OC)C1 |
| InChI | InChI=1S/C16H32N6O6/c1-5-7-8-13(6-2)9-28-16(25)19-22-11-20(17-14(23)26-3)10-21(12-22)18-15(24)27-4/h13H,5-12H2,1-4H3,(H,17,23)(H,18,24)(H,19,25) |
| InChIKey | BPKPTPCLKJMPHI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|