C8H13N3O — CID 67791758
1-[(4,4-dimethyloxetan-2-yl)methyl]-1,2,4-triazole (PubChem CID 67791758) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-[(4,4-dimethyloxetan-2-yl)methyl]-1,2,4-triazole.
| Compound Name | 1-[(4,4-dimethyloxetan-2-yl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 67791758 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 1-[(4,4-dimethyloxetan-2-yl)methyl]-1,2,4-triazole |
| SMILES | CC1(C)CC(Cn2cncn2)O1 |
| InChI | InChI=1S/C8H13N3O/c1-8(2)3-7(12-8)4-11-6-9-5-10-11/h5-7H,3-4H2,1-2H3 |
| InChIKey | IHGLBWBZHUIVDU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |