C10H10F3NO4S2 — CID 67792609
1-oxo-3-[3-(trifluoromethylsulfonyl)phenyl]-1,3-thiazolidin-5-ol (PubChem CID 67792609) has the molecular formula C10H10F3NO4S2 and a molecular weight of 329.32 g/mol. Its IUPAC name is 1-oxo-3-[3-(trifluoromethylsulfonyl)phenyl]-1,3-thiazolidin-5-ol.
| Compound Name | 1-oxo-3-[3-(trifluoromethylsulfonyl)phenyl]-1,3-thiazolidin-5-ol |
|---|---|
| PubChem CID | 67792609 |
| Molecular Formula | C10H10F3NO4S2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 1-oxo-3-[3-(trifluoromethylsulfonyl)phenyl]-1,3-thiazolidin-5-ol |
| SMILES | O=S1CN(c2cccc(S(=O)(=O)C(F)(F)F)c2)CC1O |
| InChI | InChI=1S/C10H10F3NO4S2/c11-10(12,13)20(17,18)8-3-1-2-7(4-8)14-5-9(15)19(16)6-14/h1-4,9,15H,5-6H2 |
| InChIKey | SEVMBLVFFYOWPO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |