About CID 67792760
CID 67792760 (PubChem CID 67792760) has the molecular formula C18H30NOSi
and a molecular weight of 304.53 g/mol.
Molecular Properties
| Compound Name | CID 67792760 |
| PubChem CID | 67792760 |
| Molecular Formula | C18H30NOSi |
| Molecular Weight | 304.53 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | — |
| SMILES | C[Si](C)OCC1C(C(C)(C)C)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C18H30NOSi/c1-18(2,3)16-11-12-19(17(16)14-20-21(4)5)13-15-9-7-6-8-10-15/h6-10,16-17H,11-14H2,1-5H3 |
| InChIKey | BQXDHBKIEGUYLL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67792760 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67792760?
The IUPAC name of CID 67792760 (CID 67792760) is not available.
What is the SMILES notation for CID 67792760?
The canonical SMILES for CID 67792760 is C[Si](C)OCC1C(C(C)(C)C)CCN1Cc1ccccc1.
What is the InChIKey of CID 67792760?
The InChIKey is BQXDHBKIEGUYLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30NOSi/c1-18(2,3)16-11-12-19(17(16)14-20-21(4)5)13-15-9-7-6-8-10-15/h6-10,16-17H,11-14H2,1-5H3.
What are the key properties of CID 67792760?
CID 67792760 has a molecular weight of 304.53 g/mol, XLogP of 4.19, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67792760 is sourced from PubChem (CID 67792760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).