C20H27N3O5 — CID 67793780
N'-acetyl-4-[5-[3-(hydroxymethyl)-1,2-oxazol-5-yl]pentoxy]-3,5-dimethylbenzohydrazide (PubChem CID 67793780) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is N'-acetyl-4-[5-[3-(hydroxymethyl)-1,2-oxazol-5-yl]pentoxy]-3,5-dimethylbenzohydrazide.
| Compound Name | N'-acetyl-4-[5-[3-(hydroxymethyl)-1,2-oxazol-5-yl]pentoxy]-3,5-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 67793780 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N'-acetyl-4-[5-[3-(hydroxymethyl)-1,2-oxazol-5-yl]pentoxy]-3,5-dimethylbenzohydrazide |
| SMILES | CC(=O)NNC(=O)c1cc(C)c(OCCCCCc2cc(CO)no2)c(C)c1 |
| InChI | InChI=1S/C20H27N3O5/c1-13-9-16(20(26)22-21-15(3)25)10-14(2)19(13)27-8-6-4-5-7-18-11-17(12-24)23-28-18/h9-11,24H,4-8,12H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | OIZDCXHLABDPBC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|