C19H21N3O2 — CID 67793918
[4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate (PubChem CID 67793918) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate.
| Compound Name | [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate |
|---|---|
| PubChem CID | 67793918 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(Nc2ccn(C3=CCCC=C3)n2)cc1C |
| InChI | InChI=1S/C19H21N3O2/c1-13-11-16(12-14(2)19(13)24-15(3)23)20-18-9-10-22(21-18)17-7-5-4-6-8-17/h5,7-12H,4,6H2,1-3H3,(H,20,21) |
| InChIKey | RBKIBRDWSJAIIY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|