About [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate
[4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate (PubChem CID 67793918) has the molecular formula C19H21N3O2
and a molecular weight of 323.40 g/mol. Its IUPAC name is [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate.
Molecular Properties
| Compound Name | [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate |
| PubChem CID | 67793918 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(Nc2ccn(C3=CCCC=C3)n2)cc1C |
| InChI | InChI=1S/C19H21N3O2/c1-13-11-16(12-14(2)19(13)24-15(3)23)20-18-9-10-22(21-18)17-7-5-4-6-8-17/h5,7-12H,4,6H2,1-3H3,(H,20,21) |
| InChIKey | RBKIBRDWSJAIIY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate?
The IUPAC name of [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate (CID 67793918) is [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate.
What is the SMILES notation for [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate?
The canonical SMILES for [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate is CC(=O)Oc1c(C)cc(Nc2ccn(C3=CCCC=C3)n2)cc1C.
What is the InChIKey of [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate?
The InChIKey is RBKIBRDWSJAIIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O2/c1-13-11-16(12-14(2)19(13)24-15(3)23)20-18-9-10-22(21-18)17-7-5-4-6-8-17/h5,7-12H,4,6H2,1-3H3,(H,20,21).
What are the key properties of [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate?
[4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate has a molecular weight of 323.40 g/mol, XLogP of 4.36, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(1-cyclohexa-1,5-dien-1-ylpyrazol-3-yl)amino]-2,6-dimethylphenyl] acetate is sourced from PubChem (CID 67793918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).