C21H16N2O — CID 67794200
1-hydroxy-3,4,5-triphenylpyrazole (PubChem CID 67794200) has the molecular formula C21H16N2O and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-hydroxy-3,4,5-triphenylpyrazole.
| Compound Name | 1-hydroxy-3,4,5-triphenylpyrazole |
|---|---|
| PubChem CID | 67794200 |
| Molecular Formula | C21H16N2O |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-hydroxy-3,4,5-triphenylpyrazole |
| SMILES | On1nc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C21H16N2O/c24-23-21(18-14-8-3-9-15-18)19(16-10-4-1-5-11-16)20(22-23)17-12-6-2-7-13-17/h1-15,24H |
| InChIKey | MYSCVTFEILMJRI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|