C20H34N2O2S — CID 67798880
N-[3-[4-(nonan-3-ylamino)but-1-enyl]phenyl]methanesulfonamide (PubChem CID 67798880) has the molecular formula C20H34N2O2S and a molecular weight of 366.57 g/mol. Its IUPAC name is N-[3-[4-(nonan-3-ylamino)but-1-enyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[4-(nonan-3-ylamino)but-1-enyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 67798880 |
| Molecular Formula | C20H34N2O2S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[3-[4-(nonan-3-ylamino)but-1-enyl]phenyl]methanesulfonamide |
| SMILES | CCCCCCC(CC)NCCC=Cc1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H34N2O2S/c1-4-6-7-8-14-19(5-2)21-16-10-9-12-18-13-11-15-20(17-18)22-25(3,23)24/h9,11-13,15,17,19,21-22H,4-8,10,14,16H2,1-3H3 |
| InChIKey | BJNYJYXIWBZIKC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|